C9H3F5O — CID 12673177
1,2,3,4,5-pentafluoro-6-prop-2-ynoxybenzene (PubChem CID 12673177) has the molecular formula C9H3F5O and a molecular weight of 222.11 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-prop-2-ynoxybenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-prop-2-ynoxybenzene |
|---|---|
| PubChem CID | 12673177 |
| Molecular Formula | C9H3F5O |
| Molecular Weight | 222.11 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-prop-2-ynoxybenzene |
| SMILES | C#CCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H3F5O/c1-2-3-15-9-7(13)5(11)4(10)6(12)8(9)14/h1H,3H2 |
| InChIKey | OLBNJTXXERIIEB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|