C24H23F2N9O3S — CID 126731820
N'-[3-[[5-[2,6-difluoro-3-(propylsulfonylamino)benzoyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]-N-hydrazinylideneethanimidamide (PubChem CID 126731820) has the molecular formula C24H23F2N9O3S and a molecular weight of 555.57 g/mol. Its IUPAC name is N'-[3-[[5-[2,6-difluoro-3-(propylsulfonylamino)benzoyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]-N-hydrazinylideneethanimidamide.
| Compound Name | N'-[3-[[5-[2,6-difluoro-3-(propylsulfonylamino)benzoyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]-N-hydrazinylideneethanimidamide |
|---|---|
| PubChem CID | 126731820 |
| Molecular Formula | C24H23F2N9O3S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | N'-[3-[[5-[2,6-difluoro-3-(propylsulfonylamino)benzoyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]-N-hydrazinylideneethanimidamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncnc(Nc4cccc(/N=C(C)/N=N/N)c4)c23)c1F |
| InChI | InChI=1S/C24H23F2N9O3S/c1-3-9-39(37,38)34-18-8-7-17(25)20(21(18)26)22(36)16-11-28-23-19(16)24(30-12-29-23)32-15-6-4-5-14(10-15)31-13(2)33-35-27/h4-8,10-12,34H,3,9H2,1-2H3,(H2,27,31,33)(H2,28,29,30,32) |
| InChIKey | NJJDRGROXADQNJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|