About 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide
2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 126732342) has the molecular formula C10H14F2N2O
and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide |
| PubChem CID | 126732342 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | CC(F)(F)C1=CCC(NC(=O)CN)C=C1 |
| InChI | InChI=1S/C10H14F2N2O/c1-10(11,12)7-2-4-8(5-3-7)14-9(15)6-13/h2-4,8H,5-6,13H2,1H3,(H,14,15) |
| InChIKey | UJCROQJPRNKESG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide?
The IUPAC name of 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide (CID 126732342) is 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide.
What is the SMILES notation for 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide?
The canonical SMILES for 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide is CC(F)(F)C1=CCC(NC(=O)CN)C=C1.
What is the InChIKey of 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide?
The InChIKey is UJCROQJPRNKESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O/c1-10(11,12)7-2-4-8(5-3-7)14-9(15)6-13/h2-4,8H,5-6,13H2,1H3,(H,14,15).
What are the key properties of 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide?
2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide has a molecular weight of 216.23 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[4-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-yl]acetamide is sourced from PubChem (CID 126732342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).