C42H33NO5S — CID 126732610
(2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 126732610) has the molecular formula C42H33NO5S and a molecular weight of 663.79 g/mol. Its IUPAC name is (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 126732610 |
| Molecular Formula | C42H33NO5S |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-methoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | COc1cc(-c2ccc3c(c2)C2CCCC2N3c2ccc3c(c2)-c2ccccc2C3(C)C)sc1/C=C1\C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C42H33NO5S/c1-42(2)32-9-5-4-7-25(32)28-19-24(13-15-33(28)42)43-34-10-6-8-26(34)29-17-22(12-16-35(29)43)37-21-36(48-3)38(49-37)20-31-39(44)27-14-11-23(41(46)47)18-30(27)40(31)45/h4-5,7,9,11-21,26,34H,6,8,10H2,1-3H3,(H,46,47)/b31-20+ |
| InChIKey | XDCRWCAFRNHYHH-AJBULDERSA-N |
| XLogP | 9.68 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|