C21H24IN5O3S — CID 1267330
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[1-(4-iodophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 1267330) has the molecular formula C21H24IN5O3S and a molecular weight of 553.43 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[1-(4-iodophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[1-(4-iodophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1267330 |
| Molecular Formula | C21H24IN5O3S |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[1-(4-iodophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCOc1ccc(CCNC(=O)CSc2nnnn2-c2ccc(I)cc2)cc1OCC |
| InChI | InChI=1S/C21H24IN5O3S/c1-3-29-18-10-5-15(13-19(18)30-4-2)11-12-23-20(28)14-31-21-24-25-26-27(21)17-8-6-16(22)7-9-17/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,23,28) |
| InChIKey | NMSJTLZMEJYNTJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|