About 3,5-bis(ethenoxy)-3,5-dimethylheptane
3,5-bis(ethenoxy)-3,5-dimethylheptane (PubChem CID 126733535) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 3,5-bis(ethenoxy)-3,5-dimethylheptane.
Molecular Properties
| Compound Name | 3,5-bis(ethenoxy)-3,5-dimethylheptane |
| PubChem CID | 126733535 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3,5-bis(ethenoxy)-3,5-dimethylheptane |
| SMILES | C=COC(C)(CC)CC(C)(CC)OC=C |
| InChI | InChI=1S/C13H24O2/c1-7-12(5,14-9-3)11-13(6,8-2)15-10-4/h9-10H,3-4,7-8,11H2,1-2,5-6H3 |
| InChIKey | SLJSUZVWNRNNEG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(ethenoxy)-3,5-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(ethenoxy)-3,5-dimethylheptane?
The IUPAC name of 3,5-bis(ethenoxy)-3,5-dimethylheptane (CID 126733535) is 3,5-bis(ethenoxy)-3,5-dimethylheptane.
What is the SMILES notation for 3,5-bis(ethenoxy)-3,5-dimethylheptane?
The canonical SMILES for 3,5-bis(ethenoxy)-3,5-dimethylheptane is C=COC(C)(CC)CC(C)(CC)OC=C.
What is the InChIKey of 3,5-bis(ethenoxy)-3,5-dimethylheptane?
The InChIKey is SLJSUZVWNRNNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-7-12(5,14-9-3)11-13(6,8-2)15-10-4/h9-10H,3-4,7-8,11H2,1-2,5-6H3.
What are the key properties of 3,5-bis(ethenoxy)-3,5-dimethylheptane?
3,5-bis(ethenoxy)-3,5-dimethylheptane has a molecular weight of 212.33 g/mol, XLogP of 4.03, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(ethenoxy)-3,5-dimethylheptane is sourced from PubChem (CID 126733535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).