About 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile
4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile (PubChem CID 126733548) has the molecular formula C18H16N4
and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile.
Molecular Properties
| Compound Name | 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile |
| PubChem CID | 126733548 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile |
| SMILES | C=Nc1cc(C#N)ccc1Nc1c(C)cc(C)c2[nH]ccc12 |
| InChI | InChI=1S/C18H16N4/c1-11-8-12(2)18(14-6-7-21-17(11)14)22-15-5-4-13(10-19)9-16(15)20-3/h4-9,21-22H,3H2,1-2H3 |
| InChIKey | UHIGIOCRCLXEMA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile?
The IUPAC name of 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile (CID 126733548) is 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile.
What is the SMILES notation for 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile?
The canonical SMILES for 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile is C=Nc1cc(C#N)ccc1Nc1c(C)cc(C)c2[nH]ccc12.
What is the InChIKey of 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile?
The InChIKey is UHIGIOCRCLXEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4/c1-11-8-12(2)18(14-6-7-21-17(11)14)22-15-5-4-13(10-19)9-16(15)20-3/h4-9,21-22H,3H2,1-2H3.
What are the key properties of 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile?
4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile has a molecular weight of 288.35 g/mol, XLogP of 4.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,7-dimethyl-1H-indol-4-yl)amino]-3-(methylideneamino)benzonitrile is sourced from PubChem (CID 126733548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).