About N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide
N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide (PubChem CID 126733573) has the molecular formula C16H30N6O2
and a molecular weight of 338.46 g/mol. Its IUPAC name is N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide |
| PubChem CID | 126733573 |
| Molecular Formula | C16H30N6O2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide |
| SMILES | C/N=C(\N)NCCCC1NCC(C(=O)NC2CCCCC2)NC1=O |
| InChI | InChI=1S/C16H30N6O2/c1-18-16(17)19-9-5-8-12-14(23)22-13(10-20-12)15(24)21-11-6-3-2-4-7-11/h11-13,20H,2-10H2,1H3,(H,21,24)(H,22,23)(H3,17,18,19) |
| InChIKey | VFTVPNYIUPAZLA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide?
The IUPAC name of N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide (CID 126733573) is N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide.
What is the SMILES notation for N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide?
The canonical SMILES for N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide is C/N=C(\N)NCCCC1NCC(C(=O)NC2CCCCC2)NC1=O.
What is the InChIKey of N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide?
The InChIKey is VFTVPNYIUPAZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N6O2/c1-18-16(17)19-9-5-8-12-14(23)22-13(10-20-12)15(24)21-11-6-3-2-4-7-11/h11-13,20H,2-10H2,1H3,(H,21,24)(H,22,23)(H3,17,18,19).
What are the key properties of N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide?
N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide has a molecular weight of 338.46 g/mol, XLogP of -0.79, 6 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5-[3-[(N'-methylcarbamimidoyl)amino]propyl]-6-oxopiperazine-2-carboxamide is sourced from PubChem (CID 126733573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).