About 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole
3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole (PubChem CID 126733586) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole |
| PubChem CID | 126733586 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole |
| SMILES | C=C1N=C(C(C)C)C(C)C1C |
| InChI | InChI=1S/C10H17N/c1-6(2)10-8(4)7(3)9(5)11-10/h6-8H,5H2,1-4H3 |
| InChIKey | FFWWYTQMISYRCI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole?
The IUPAC name of 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole (CID 126733586) is 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole.
What is the SMILES notation for 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole?
The canonical SMILES for 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole is C=C1N=C(C(C)C)C(C)C1C.
What is the InChIKey of 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole?
The InChIKey is FFWWYTQMISYRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-6(2)10-8(4)7(3)9(5)11-10/h6-8H,5H2,1-4H3.
What are the key properties of 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole?
3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-methylidene-5-propan-2-yl-3,4-dihydropyrrole is sourced from PubChem (CID 126733586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).