About 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine
4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine (PubChem CID 126733664) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine.
Molecular Properties
| Compound Name | 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine |
| PubChem CID | 126733664 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine |
| SMILES | C=C/C=C\c1ccc2cc3ccc(C)c(/C=C\C=C)c3nc2c1 |
| InChI | InChI=1S/C22H19N/c1-4-6-8-17-11-13-18-15-19-12-10-16(3)20(9-7-5-2)22(19)23-21(18)14-17/h4-15H,1-2H2,3H3/b8-6-,9-7- |
| InChIKey | SOMUEZBYEQMBAN-VRHVFUOLSA-N |
| XLogP | 6.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine?
The IUPAC name of 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine (CID 126733664) is 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine.
What is the SMILES notation for 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine?
The canonical SMILES for 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine is C=C/C=C\c1ccc2cc3ccc(C)c(/C=C\C=C)c3nc2c1.
What is the InChIKey of 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine?
The InChIKey is SOMUEZBYEQMBAN-VRHVFUOLSA-N. The full InChI is InChI=1S/C22H19N/c1-4-6-8-17-11-13-18-15-19-12-10-16(3)20(9-7-5-2)22(19)23-21(18)14-17/h4-15H,1-2H2,3H3/b8-6-,9-7-.
What are the key properties of 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine?
4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine has a molecular weight of 297.40 g/mol, XLogP of 6.09, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis[(1Z)-buta-1,3-dienyl]-3-methylacridine is sourced from PubChem (CID 126733664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).