C14H18F3N3O2S — CID 126733753
(6R)-6-(5-amino-2-fluorophenyl)-5,5-difluoro-3,6-dimethyl-3-methylsulfonyl-4H-pyridin-2-amine (PubChem CID 126733753) has the molecular formula C14H18F3N3O2S and a molecular weight of 349.38 g/mol. Its IUPAC name is (6R)-6-(5-amino-2-fluorophenyl)-5,5-difluoro-3,6-dimethyl-3-methylsulfonyl-4H-pyridin-2-amine.
| Compound Name | (6R)-6-(5-amino-2-fluorophenyl)-5,5-difluoro-3,6-dimethyl-3-methylsulfonyl-4H-pyridin-2-amine |
|---|---|
| PubChem CID | 126733753 |
| Molecular Formula | C14H18F3N3O2S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (6R)-6-(5-amino-2-fluorophenyl)-5,5-difluoro-3,6-dimethyl-3-methylsulfonyl-4H-pyridin-2-amine |
| SMILES | CC1(S(C)(=O)=O)CC(F)(F)[C@@](C)(c2cc(N)ccc2F)N=C1N |
| InChI | InChI=1S/C14H18F3N3O2S/c1-12(23(3,21)22)7-14(16,17)13(2,20-11(12)19)9-6-8(18)4-5-10(9)15/h4-6H,7,18H2,1-3H3,(H2,19,20)/t12?,13-/m1/s1 |
| InChIKey | ZJXVFCSZMUUQIG-ZGTCLIOFSA-N |
| XLogP | 1.82 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|