C14H25N3 — CID 126734368
(1Z,2E)-5-hex-1-en-2-yl-3,9-dimethyl-4,6,7,8-tetrahydro-1,2,5-triazonine (PubChem CID 126734368) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (1Z,2E)-5-hex-1-en-2-yl-3,9-dimethyl-4,6,7,8-tetrahydro-1,2,5-triazonine.
| Compound Name | (1Z,2E)-5-hex-1-en-2-yl-3,9-dimethyl-4,6,7,8-tetrahydro-1,2,5-triazonine |
|---|---|
| PubChem CID | 126734368 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (1Z,2E)-5-hex-1-en-2-yl-3,9-dimethyl-4,6,7,8-tetrahydro-1,2,5-triazonine |
| SMILES | C=C(CCCC)N1CCC/C(C)=N\N=C(\C)C1 |
| InChI | InChI=1S/C14H25N3/c1-5-6-9-14(4)17-10-7-8-12(2)15-16-13(3)11-17/h4-11H2,1-3H3/b15-12-,16-13- |
| InChIKey | DTXIXMPYEQBLCJ-BNXAACBSSA-N |
| XLogP | 3.62 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |