About 3-piperazin-1-yl-4a,5-dihydroisoquinoline
3-piperazin-1-yl-4a,5-dihydroisoquinoline (PubChem CID 126734510) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-piperazin-1-yl-4a,5-dihydroisoquinoline.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-4a,5-dihydroisoquinoline |
| PubChem CID | 126734510 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-piperazin-1-yl-4a,5-dihydroisoquinoline |
| SMILES | C1=CCC2C=C(N3CCNCC3)N=CC2=C1 |
| InChI | InChI=1S/C13H17N3/c1-2-4-12-10-15-13(9-11(12)3-1)16-7-5-14-6-8-16/h1-2,4,9-11,14H,3,5-8H2 |
| InChIKey | FVDCMZWZGOJOBM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-piperazin-1-yl-4a,5-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-4a,5-dihydroisoquinoline?
The IUPAC name of 3-piperazin-1-yl-4a,5-dihydroisoquinoline (CID 126734510) is 3-piperazin-1-yl-4a,5-dihydroisoquinoline.
What is the SMILES notation for 3-piperazin-1-yl-4a,5-dihydroisoquinoline?
The canonical SMILES for 3-piperazin-1-yl-4a,5-dihydroisoquinoline is C1=CCC2C=C(N3CCNCC3)N=CC2=C1.
What is the InChIKey of 3-piperazin-1-yl-4a,5-dihydroisoquinoline?
The InChIKey is FVDCMZWZGOJOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-2-4-12-10-15-13(9-11(12)3-1)16-7-5-14-6-8-16/h1-2,4,9-11,14H,3,5-8H2.
What are the key properties of 3-piperazin-1-yl-4a,5-dihydroisoquinoline?
3-piperazin-1-yl-4a,5-dihydroisoquinoline has a molecular weight of 215.30 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-4a,5-dihydroisoquinoline is sourced from PubChem (CID 126734510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).