C22H28N2O — CID 126735085
1-(4-ethyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)propan-1-one (PubChem CID 126735085) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(4-ethyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)propan-1-one.
| Compound Name | 1-(4-ethyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 126735085 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-(4-ethyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)propan-1-one |
| SMILES | CCC1=C2CCCCC2N(C(=O)CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H28N2O/c1-2-16-13-14-24(21-10-6-4-8-19(16)21)22(25)12-11-17-15-23-20-9-5-3-7-18(17)20/h3,5,7,9,15,21,23H,2,4,6,8,10-14H2,1H3 |
| InChIKey | DYXDGSKHHJRFBB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|