C26H32N2OS — CID 126735147
1-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-(4-thiophen-2-yl-1H-indol-3-yl)butan-1-one (PubChem CID 126735147) has the molecular formula C26H32N2OS and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-(4-thiophen-2-yl-1H-indol-3-yl)butan-1-one.
| Compound Name | 1-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-(4-thiophen-2-yl-1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 126735147 |
| Molecular Formula | C26H32N2OS |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-(4-thiophen-2-yl-1H-indol-3-yl)butan-1-one |
| SMILES | CC(CC(=O)N1CCCC2C(C)CCCC21)c1c[nH]c2cccc(-c3cccs3)c12 |
| InChI | InChI=1S/C26H32N2OS/c1-17-7-3-11-23-19(17)9-5-13-28(23)25(29)15-18(2)21-16-27-22-10-4-8-20(26(21)22)24-12-6-14-30-24/h4,6,8,10,12,14,16-19,23,27H,3,5,7,9,11,13,15H2,1-2H3 |
| InChIKey | GXMXKWIUSTVTAH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |