About (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine
(3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine (PubChem CID 126735355) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine |
| PubChem CID | 126735355 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine |
| SMILES | CCC/C=C(\C=C(/N)C(C)C)OC |
| InChI | InChI=1S/C11H21NO/c1-5-6-7-10(13-4)8-11(12)9(2)3/h7-9H,5-6,12H2,1-4H3/b10-7+,11-8- |
| InChIKey | YWQYFEKKAJXTAF-WAKDDQPJSA-N |
| XLogP | 2.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine?
The IUPAC name of (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine (CID 126735355) is (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine.
What is the SMILES notation for (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine?
The canonical SMILES for (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine is CCC/C=C(\C=C(/N)C(C)C)OC.
What is the InChIKey of (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine?
The InChIKey is YWQYFEKKAJXTAF-WAKDDQPJSA-N. The full InChI is InChI=1S/C11H21NO/c1-5-6-7-10(13-4)8-11(12)9(2)3/h7-9H,5-6,12H2,1-4H3/b10-7+,11-8-.
What are the key properties of (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine?
(3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine has a molecular weight of 183.29 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-methoxy-2-methylnona-3,5-dien-3-amine is sourced from PubChem (CID 126735355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).