C35H22F8O8S2 — CID 126735509
5-[4-[4-[(3,4-dimethyl-6-sulfo-4,4a-dihydronaphthalen-1-yl)oxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-7-methylnaphthalene-2-sulfonic acid (PubChem CID 126735509) has the molecular formula C35H22F8O8S2 and a molecular weight of 786.67 g/mol. Its IUPAC name is 5-[4-[4-[(3,4-dimethyl-6-sulfo-4,4a-dihydronaphthalen-1-yl)oxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-7-methylnaphthalene-2-sulfonic acid.
| Compound Name | 5-[4-[4-[(3,4-dimethyl-6-sulfo-4,4a-dihydronaphthalen-1-yl)oxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-7-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 126735509 |
| Molecular Formula | C35H22F8O8S2 |
| Molecular Weight | 786.67 g/mol |
| Exact Mass | 786.06 |
| IUPAC Name | 5-[4-[4-[(3,4-dimethyl-6-sulfo-4,4a-dihydronaphthalen-1-yl)oxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-7-methylnaphthalene-2-sulfonic acid |
| SMILES | CC1=CC(Oc2c(F)c(F)c(-c3c(F)c(F)c(Oc4cc(C)cc5cc(S(=O)(=O)O)ccc45)c(F)c3F)c(F)c2F)=C2C=CC(S(=O)(=O)O)=CC2C1C |
| InChI | InChI=1S/C35H22F8O8S2/c1-13-8-16-11-17(52(44,45)46)4-6-19(16)22(9-13)50-34-30(40)26(36)24(27(37)31(34)41)25-28(38)32(42)35(33(43)29(25)39)51-23-10-14(2)15(3)21-12-18(53(47,48)49)5-7-20(21)23/h4-12,15,21H,1-3H3,(H,44,45,46)(H,47,48,49) |
| InChIKey | GWICPXBNTGFUGU-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.67 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|