About 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole
2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole (PubChem CID 126735644) has the molecular formula C18H30F2N2
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole.
Molecular Properties
| Compound Name | 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole |
| PubChem CID | 126735644 |
| Molecular Formula | C18H30F2N2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole |
| SMILES | Cn1c(CC(C)(C)C2CCC(F)(F)CC2)cnc1C(C)(C)C |
| InChI | InChI=1S/C18H30F2N2/c1-16(2,3)15-21-12-14(22(15)6)11-17(4,5)13-7-9-18(19,20)10-8-13/h12-13H,7-11H2,1-6H3 |
| InChIKey | CMTZCOCBKLJZOD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole?
The IUPAC name of 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole (CID 126735644) is 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole.
What is the SMILES notation for 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole?
The canonical SMILES for 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole is Cn1c(CC(C)(C)C2CCC(F)(F)CC2)cnc1C(C)(C)C.
What is the InChIKey of 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole?
The InChIKey is CMTZCOCBKLJZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30F2N2/c1-16(2,3)15-21-12-14(22(15)6)11-17(4,5)13-7-9-18(19,20)10-8-13/h12-13H,7-11H2,1-6H3.
What are the key properties of 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole?
2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole has a molecular weight of 312.45 g/mol, XLogP of 5.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-[2-(4,4-difluorocyclohexyl)-2-methylpropyl]-1-methylimidazole is sourced from PubChem (CID 126735644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).