About (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine
(3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine (PubChem CID 126735651) has the molecular formula C14H25NO2S
and a molecular weight of 271.43 g/mol. Its IUPAC name is (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine.
Molecular Properties
| Compound Name | (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine |
| PubChem CID | 126735651 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine |
| SMILES | C/C(=C\C=C(/C1CCCCC1)S(C)(=O)=O)C(C)N |
| InChI | InChI=1S/C14H25NO2S/c1-11(12(2)15)9-10-14(18(3,16)17)13-7-5-4-6-8-13/h9-10,12-13H,4-8,15H2,1-3H3/b11-9+,14-10+ |
| InChIKey | XJJQTVJUUPNHGO-LRGIMLIUSA-N |
| XLogP | 2.79 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine?
The IUPAC name of (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine (CID 126735651) is (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine.
What is the SMILES notation for (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine?
The canonical SMILES for (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine is C/C(=C\C=C(/C1CCCCC1)S(C)(=O)=O)C(C)N.
What is the InChIKey of (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine?
The InChIKey is XJJQTVJUUPNHGO-LRGIMLIUSA-N. The full InChI is InChI=1S/C14H25NO2S/c1-11(12(2)15)9-10-14(18(3,16)17)13-7-5-4-6-8-13/h9-10,12-13H,4-8,15H2,1-3H3/b11-9+,14-10+.
What are the key properties of (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine?
(3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine has a molecular weight of 271.43 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-cyclohexyl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine is sourced from PubChem (CID 126735651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).