C27H30FN5O6S — CID 126735671
2-(2-fluoro-3,5-dimethoxy-N-[3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]anilino)ethyl methanesulfonate (PubChem CID 126735671) has the molecular formula C27H30FN5O6S and a molecular weight of 571.63 g/mol. Its IUPAC name is 2-(2-fluoro-3,5-dimethoxy-N-[3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]anilino)ethyl methanesulfonate.
| Compound Name | 2-(2-fluoro-3,5-dimethoxy-N-[3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]anilino)ethyl methanesulfonate |
|---|---|
| PubChem CID | 126735671 |
| Molecular Formula | C27H30FN5O6S |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 2-(2-fluoro-3,5-dimethoxy-N-[3-[1-(oxan-2-yl)pyrazol-4-yl]quinoxalin-6-yl]anilino)ethyl methanesulfonate |
| SMILES | COc1cc(OC)c(F)c(N(CCOS(C)(=O)=O)c2ccc3ncc(-c4cnn(C5CCCCO5)c4)nc3c2)c1 |
| InChI | InChI=1S/C27H30FN5O6S/c1-36-20-13-24(27(28)25(14-20)37-2)32(9-11-39-40(3,34)35)19-7-8-21-22(12-19)31-23(16-29-21)18-15-30-33(17-18)26-6-4-5-10-38-26/h7-8,12-17,26H,4-6,9-11H2,1-3H3 |
| InChIKey | WWKUEGYSYVVWBT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|