C14H23NO2S — CID 126735693
(2R,3E,5E)-6-cyclohex-2-en-1-yl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine (PubChem CID 126735693) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is (2R,3E,5E)-6-cyclohex-2-en-1-yl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine.
| Compound Name | (2R,3E,5E)-6-cyclohex-2-en-1-yl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 126735693 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2R,3E,5E)-6-cyclohex-2-en-1-yl-3-methyl-6-methylsulfonylhexa-3,5-dien-2-amine |
| SMILES | C/C(=C\C=C(/C1C=CCCC1)S(C)(=O)=O)[C@@H](C)N |
| InChI | InChI=1S/C14H23NO2S/c1-11(12(2)15)9-10-14(18(3,16)17)13-7-5-4-6-8-13/h5,7,9-10,12-13H,4,6,8,15H2,1-3H3/b11-9+,14-10+/t12-,13?/m1/s1 |
| InChIKey | HHJSRXJEALCICX-RMHYCNBISA-N |
| XLogP | 2.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|