C15H23NO2S — CID 126735696
4a-(1-ethylsulfonylethenyl)-3-methylidene-1,2,4,5,6,7-hexahydronaphthalen-2-amine (PubChem CID 126735696) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 4a-(1-ethylsulfonylethenyl)-3-methylidene-1,2,4,5,6,7-hexahydronaphthalen-2-amine.
| Compound Name | 4a-(1-ethylsulfonylethenyl)-3-methylidene-1,2,4,5,6,7-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 126735696 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4a-(1-ethylsulfonylethenyl)-3-methylidene-1,2,4,5,6,7-hexahydronaphthalen-2-amine |
| SMILES | C=C1CC2(C(=C)S(=O)(=O)CC)CCCC=C2CC1N |
| InChI | InChI=1S/C15H23NO2S/c1-4-19(17,18)12(3)15-8-6-5-7-13(15)9-14(16)11(2)10-15/h7,14H,2-6,8-10,16H2,1H3 |
| InChIKey | WZFOFZCCUFZVHV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|