C12H10O6 — CID 126736029
8-ethyl-4a,7a,8,8a-tetrahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 126736029) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is 8-ethyl-4a,7a,8,8a-tetrahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 8-ethyl-4a,7a,8,8a-tetrahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 126736029 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 8-ethyl-4a,7a,8,8a-tetrahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | CCC1C2C(=O)OC(=O)C2=CC2C(=O)OC(=O)C21 |
| InChI | InChI=1S/C12H10O6/c1-2-4-7-5(9(13)17-11(7)15)3-6-8(4)12(16)18-10(6)14/h3-5,7-8H,2H2,1H3 |
| InChIKey | DXRBFGWTEDHVFI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|