C8H11BrN4S2 — CID 126736200
(5S)-5-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine (PubChem CID 126736200) has the molecular formula C8H11BrN4S2 and a molecular weight of 307.24 g/mol. Its IUPAC name is (5S)-5-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 126736200 |
| Molecular Formula | C8H11BrN4S2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | (5S)-5-(4-bromo-1,3-thiazol-2-yl)-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1SC[C@@](C)(c2nc(Br)cs2)N=C1N |
| InChI | InChI=1S/C8H11BrN4S2/c1-8(6-11-5(9)3-14-6)4-15-13(2)7(10)12-8/h3H,4H2,1-2H3,(H2,10,12)/t8-/m0/s1 |
| InChIKey | SPOYSQHINLRTPR-QMMMGPOBSA-N |
| XLogP | 2.03 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|