About 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid
6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 126736205) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 126736205 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCC1(OC(C)=O)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-3-4-8-13(17-10(2)14)9-6-5-7-11(13)12(15)16/h5-7,9,11H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | RNSHOUJTMBSLLB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid (CID 126736205) is 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid is CCCCC1(OC(C)=O)C=CC=CC1C(=O)O.
What is the InChIKey of 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is RNSHOUJTMBSLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-3-4-8-13(17-10(2)14)9-6-5-7-11(13)12(15)16/h5-7,9,11H,3-4,8H2,1-2H3,(H,15,16).
What are the key properties of 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid?
6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 238.28 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyloxy-6-butylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 126736205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).