C16H17N3 — CID 126736209
3-[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-5-[(Z)-prop-1-enyl]-1H-imidazo[1,2-a]imidazole (PubChem CID 126736209) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-5-[(Z)-prop-1-enyl]-1H-imidazo[1,2-a]imidazole.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-5-[(Z)-prop-1-enyl]-1H-imidazo[1,2-a]imidazole |
|---|---|
| PubChem CID | 126736209 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-5-[(Z)-prop-1-enyl]-1H-imidazo[1,2-a]imidazole |
| SMILES | C=C/C=C\c1c(C=C)[nH]c2nc(C=C)c(/C=C\C)n12 |
| InChI | InChI=1S/C16H17N3/c1-5-9-11-15-13(8-4)18-16-17-12(7-3)14(10-6-2)19(15)16/h5-11H,1,3-4H2,2H3,(H,17,18)/b10-6-,11-9- |
| InChIKey | FZVBRWSOZOASCY-ZUYWJZQFSA-N |
| XLogP | 4.18 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|