C17H23NO6 — CID 126736977
(3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 126736977) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 126736977 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COCO[C@H]1C(=O)N(c2ccc(OC)cc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H23NO6/c1-17(2)23-9-13(24-17)14-15(22-10-20-3)16(19)18(14)11-5-7-12(21-4)8-6-11/h5-8,13-15H,9-10H2,1-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | RLOPUQIQHOICSI-QLFBSQMISA-N |
| XLogP | 1.55 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|