About dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate
dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate (PubChem CID 126737098) has the molecular formula C34H27Br2NO4
and a molecular weight of 673.40 g/mol. Its IUPAC name is dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate.
Molecular Properties
| Compound Name | dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate |
| PubChem CID | 126737098 |
| Molecular Formula | C34H27Br2NO4 |
| Molecular Weight | 673.40 g/mol |
| Exact Mass | 671.03 |
| IUPAC Name | dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc2c(c1)c1cc(C(=O)OCCC)ccc1n2-c1ccc(C#Cc2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C34H27Br2NO4/c1-3-15-40-33(38)24-9-13-31-29(19-24)30-20-25(34(39)41-16-4-2)10-14-32(30)37(31)28-11-7-22(8-12-28)5-6-23-17-26(35)21-27(36)18-23/h7-14,17-21H,3-4,15-16H2,1-2H3 |
| InChIKey | PQDCHQGTIWMZEP-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.40 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate?
The IUPAC name of dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate (CID 126737098) is dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate.
What is the SMILES notation for dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate?
The canonical SMILES for dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate is CCCOC(=O)c1ccc2c(c1)c1cc(C(=O)OCCC)ccc1n2-c1ccc(C#Cc2cc(Br)cc(Br)c2)cc1.
What is the InChIKey of dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate?
The InChIKey is PQDCHQGTIWMZEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H27Br2NO4/c1-3-15-40-33(38)24-9-13-31-29(19-24)30-20-25(34(39)41-16-4-2)10-14-32(30)37(31)28-11-7-22(8-12-28)5-6-23-17-26(35)21-27(36)18-23/h7-14,17-21H,3-4,15-16H2,1-2H3.
What are the key properties of dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate?
dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate has a molecular weight of 673.40 g/mol, XLogP of 8.84, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]carbazole-3,6-dicarboxylate is sourced from PubChem (CID 126737098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).