About dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate
dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate (PubChem CID 126737105) has the molecular formula C26H24INO4
and a molecular weight of 541.39 g/mol. Its IUPAC name is dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate.
Molecular Properties
| Compound Name | dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate |
| PubChem CID | 126737105 |
| Molecular Formula | C26H24INO4 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc2c(c1)c1cc(C(=O)OCCC)ccc1n2-c1ccc(I)cc1 |
| InChI | InChI=1S/C26H24INO4/c1-3-13-31-25(29)17-5-11-23-21(15-17)22-16-18(26(30)32-14-4-2)6-12-24(22)28(23)20-9-7-19(27)8-10-20/h5-12,15-16H,3-4,13-14H2,1-2H3 |
| InChIKey | FUYDKQJVZUASMA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate?
The IUPAC name of dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate (CID 126737105) is dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate.
What is the SMILES notation for dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate?
The canonical SMILES for dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate is CCCOC(=O)c1ccc2c(c1)c1cc(C(=O)OCCC)ccc1n2-c1ccc(I)cc1.
What is the InChIKey of dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate?
The InChIKey is FUYDKQJVZUASMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24INO4/c1-3-13-31-25(29)17-5-11-23-21(15-17)22-16-18(26(30)32-14-4-2)6-12-24(22)28(23)20-9-7-19(27)8-10-20/h5-12,15-16H,3-4,13-14H2,1-2H3.
What are the key properties of dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate?
dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate has a molecular weight of 541.39 g/mol, XLogP of 6.52, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl 9-(4-iodophenyl)carbazole-3,6-dicarboxylate is sourced from PubChem (CID 126737105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).