About N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide
N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide (PubChem CID 126737316) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide |
| PubChem CID | 126737316 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-7-11(9(3)12)8(2)10(4,5)6/h8H,7H2,1-6H3/t8-/m0/s1 |
| InChIKey | WKPQEINHUGAEQW-QMMMGPOBSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide?
The IUPAC name of N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide (CID 126737316) is N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide.
What is the SMILES notation for N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide?
The canonical SMILES for N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide is CCN(C(C)=O)[C@@H](C)C(C)(C)C.
What is the InChIKey of N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide?
The InChIKey is WKPQEINHUGAEQW-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H21NO/c1-7-11(9(3)12)8(2)10(4,5)6/h8H,7H2,1-6H3/t8-/m0/s1.
What are the key properties of N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide?
N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide has a molecular weight of 171.28 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-dimethylbutan-2-yl]-N-ethylacetamide is sourced from PubChem (CID 126737316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).