C23H34N4O5 — CID 126737502
tert-butyl N-[3-[4-[cyclohexyl(methyl)carbamoyl]-2-nitroanilino]cyclobutyl]carbamate (PubChem CID 126737502) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[cyclohexyl(methyl)carbamoyl]-2-nitroanilino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[cyclohexyl(methyl)carbamoyl]-2-nitroanilino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 126737502 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | tert-butyl N-[3-[4-[cyclohexyl(methyl)carbamoyl]-2-nitroanilino]cyclobutyl]carbamate |
| SMILES | CN(C(=O)c1ccc(NC2CC(NC(=O)OC(C)(C)C)C2)c([N+](=O)[O-])c1)C1CCCCC1 |
| InChI | InChI=1S/C23H34N4O5/c1-23(2,3)32-22(29)25-17-13-16(14-17)24-19-11-10-15(12-20(19)27(30)31)21(28)26(4)18-8-6-5-7-9-18/h10-12,16-18,24H,5-9,13-14H2,1-4H3,(H,25,29) |
| InChIKey | UKJHCWNZTRFTMM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|