C30H48O3 — CID 126737807
methyl (2S,6aS,6bR,12aR,14bS)-2,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate (PubChem CID 126737807) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is methyl (2S,6aS,6bR,12aR,14bS)-2,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate.
| Compound Name | methyl (2S,6aS,6bR,12aR,14bS)-2,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 126737807 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | methyl (2S,6aS,6bR,12aR,14bS)-2,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CC[C@H](C)C[C@H]1C1CCC3[C@@]4(C)CCC(=O)C(C)(C)C4CC[C@@]3(C)[C@@]1(C)CC2 |
| InChI | InChI=1S/C30H48O3/c1-19-10-15-30(25(32)33-7)17-16-28(5)20(21(30)18-19)8-9-23-27(4)13-12-24(31)26(2,3)22(27)11-14-29(23,28)6/h19-23H,8-18H2,1-7H3/t19-,20?,21-,22?,23?,27-,28-,29+,30?/m0/s1 |
| InChIKey | COHZGFWUSAOZAS-QOICSSIESA-N |
| XLogP | 7.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |