About N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide
N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 126738059) has the molecular formula C18H15N5O3
and a molecular weight of 349.35 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 126738059 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | Nc1cccc(-n2c(NC(=O)c3ccno3)nc3cc(CO)ccc32)c1 |
| InChI | InChI=1S/C18H15N5O3/c19-12-2-1-3-13(9-12)23-15-5-4-11(10-24)8-14(15)21-18(23)22-17(25)16-6-7-20-26-16/h1-9,24H,10,19H2,(H,21,22,25) |
| InChIKey | OWCFKRIIQUAVRV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide (CID 126738059) is N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide is Nc1cccc(-n2c(NC(=O)c3ccno3)nc3cc(CO)ccc32)c1.
What is the InChIKey of N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide?
The InChIKey is OWCFKRIIQUAVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O3/c19-12-2-1-3-13(9-12)23-15-5-4-11(10-24)8-14(15)21-18(23)22-17(25)16-6-7-20-26-16/h1-9,24H,10,19H2,(H,21,22,25).
What are the key properties of N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide?
N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide has a molecular weight of 349.35 g/mol, XLogP of 2.34, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-aminophenyl)-5-(hydroxymethyl)benzimidazol-2-yl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 126738059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).