C34H32N6O4 — CID 126738536
[3-[5-[(4-aminobenzoyl)amino]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 126738536) has the molecular formula C34H32N6O4 and a molecular weight of 588.67 g/mol. Its IUPAC name is [3-[5-[(4-aminobenzoyl)amino]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [3-[5-[(4-aminobenzoyl)amino]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 126738536 |
| Molecular Formula | C34H32N6O4 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | [3-[5-[(4-aminobenzoyl)amino]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2cc3c(c4ccccc24)CCN3C(=O)c2cc3cc(NC(=O)c4ccc(N)cc4)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C34H32N6O4/c1-38-14-16-39(17-15-38)34(43)44-31-20-30-26(25-4-2-3-5-27(25)31)12-13-40(30)33(42)29-19-22-18-24(10-11-28(22)37-29)36-32(41)21-6-8-23(35)9-7-21/h2-11,18-20,37H,12-17,35H2,1H3,(H,36,41) |
| InChIKey | JTFQUNQHLATJHY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|