C16H29F — CID 126738537
(2R)-2-[(E,3S)-3-fluoro-5,6-dimethyloct-5-en-2-yl]-1,1-dimethylcyclobutane (PubChem CID 126738537) has the molecular formula C16H29F and a molecular weight of 240.41 g/mol. Its IUPAC name is (2R)-2-[(E,3S)-3-fluoro-5,6-dimethyloct-5-en-2-yl]-1,1-dimethylcyclobutane.
| Compound Name | (2R)-2-[(E,3S)-3-fluoro-5,6-dimethyloct-5-en-2-yl]-1,1-dimethylcyclobutane |
|---|---|
| PubChem CID | 126738537 |
| Molecular Formula | C16H29F |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | (2R)-2-[(E,3S)-3-fluoro-5,6-dimethyloct-5-en-2-yl]-1,1-dimethylcyclobutane |
| SMILES | CC/C(C)=C(\C)C[C@H](F)C(C)[C@H]1CCC1(C)C |
| InChI | InChI=1S/C16H29F/c1-7-11(2)12(3)10-15(17)13(4)14-8-9-16(14,5)6/h13-15H,7-10H2,1-6H3/b12-11+/t13?,14-,15+/m1/s1 |
| InChIKey | NFVUPURKLISCGO-DICFQYPUSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|