C36H32F6N4O6S2 — CID 126738771
5,7-bis[(E)-2-(1-methylpyrrol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) (PubChem CID 126738771) has the molecular formula C36H32F6N4O6S2 and a molecular weight of 794.80 g/mol. Its IUPAC name is 5,7-bis[(E)-2-(1-methylpyrrol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate).
| Compound Name | 5,7-bis[(E)-2-(1-methylpyrrol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 126738771 |
| Molecular Formula | C36H32F6N4O6S2 |
| Molecular Weight | 794.80 g/mol |
| Exact Mass | 794.17 |
| IUPAC Name | 5,7-bis[(E)-2-(1-methylpyrrol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
| SMILES | Cn1cccc1/C=C/c1cc(/C=C/c2cccn2C)[n+]2c(c1)-c1c(ccc3c1-c1cccc[n+]1CC3)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C34H32N4.2CHF3O3S/c1-35-18-5-7-28(35)13-10-25-23-30(15-14-29-8-6-19-36(29)2)38-22-17-27-12-11-26-16-21-37-20-4-3-9-31(37)33(26)34(27)32(38)24-25;2*2-1(3,4)8(5,6)7/h3-15,18-20,23-24H,16-17,21-22H2,1-2H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | NGCKPTLERJVNOV-UHFFFAOYSA-L |
| XLogP | 5.83 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|