C42H32F6N4O6S2 — CID 126738790
5,7-bis[(E)-2-(1H-indol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) (PubChem CID 126738790) has the molecular formula C42H32F6N4O6S2 and a molecular weight of 866.86 g/mol. Its IUPAC name is 5,7-bis[(E)-2-(1H-indol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate).
| Compound Name | 5,7-bis[(E)-2-(1H-indol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 126738790 |
| Molecular Formula | C42H32F6N4O6S2 |
| Molecular Weight | 866.86 g/mol |
| Exact Mass | 866.17 |
| IUPAC Name | 5,7-bis[(E)-2-(1H-indol-2-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
| SMILES | C(=C/c1cc2ccccc2[nH]1)\c1cc(/C=C/c2cc3ccccc3[nH]2)[n+]2c(c1)-c1c(ccc3c1-c1cccc[n+]1CC3)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C40H31N4.2CHF3O3S/c1-3-9-35-30(7-1)25-32(41-35)15-12-27-23-34(17-16-33-26-31-8-2-4-10-36(31)42-33)44-22-19-29-14-13-28-18-21-43-20-6-5-11-37(43)39(28)40(29)38(44)24-27;2*2-1(3,4)8(5,6)7/h1-17,20,23-26H,18-19,21-22H2,(H,41,42);2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | UUFBUUOHRMXBQS-UHFFFAOYSA-M |
| XLogP | 8.11 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.86 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|