C36H26F6N2O7S2 — CID 126738884
5-[(E)-2-dibenzofuran-4-ylethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) (PubChem CID 126738884) has the molecular formula C36H26F6N2O7S2 and a molecular weight of 776.73 g/mol. Its IUPAC name is 5-[(E)-2-dibenzofuran-4-ylethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene;bis(trifluoromethanesulfonate).
| Compound Name | 5-[(E)-2-dibenzofuran-4-ylethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 126738884 |
| Molecular Formula | C36H26F6N2O7S2 |
| Molecular Weight | 776.73 g/mol |
| Exact Mass | 776.11 |
| IUPAC Name | 5-[(E)-2-dibenzofuran-4-ylethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene;bis(trifluoromethanesulfonate) |
| SMILES | C(=C/c1cccc2c1oc1ccccc12)\c1cc[n+]2c(c1)-c1c(ccc3c1-c1cccc[n+]1CC3)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C34H26N2O.2CHF3O3S/c1-2-10-31-27(7-1)28-8-5-6-26(34(28)37-31)12-11-23-15-19-36-21-17-25-14-13-24-16-20-35-18-4-3-9-29(35)32(24)33(25)30(36)22-23;2*2-1(3,4)8(5,6)7/h1-15,18-19,22H,16-17,20-21H2;2*(H,5,6,7)/q+2;;/p-2/b12-11+;; |
| InChIKey | OWLDKMAQBKKNEB-YHPRVSEPSA-L |
| XLogP | 6.88 |
| TPSA | 135.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|