C29H33FN6O2 — CID 126738939
N-[4-[(1R,3S,5S)-3-amino-5-methylcyclohexyl]-3-pyridinyl]-5-fluoro-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)quinoline-8-carboxamide (PubChem CID 126738939) has the molecular formula C29H33FN6O2 and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[4-[(1R,3S,5S)-3-amino-5-methylcyclohexyl]-3-pyridinyl]-5-fluoro-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)quinoline-8-carboxamide.
| Compound Name | N-[4-[(1R,3S,5S)-3-amino-5-methylcyclohexyl]-3-pyridinyl]-5-fluoro-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 126738939 |
| Molecular Formula | C29H33FN6O2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | N-[4-[(1R,3S,5S)-3-amino-5-methylcyclohexyl]-3-pyridinyl]-5-fluoro-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)quinoline-8-carboxamide |
| SMILES | C[C@@H]1C[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c3cc(N4CCN5C(=O)CCC5C4)cnc23)C1 |
| InChI | InChI=1S/C29H33FN6O2/c1-17-10-18(12-19(31)11-17)22-6-7-32-15-26(22)34-29(38)23-3-4-25(30)24-13-21(14-33-28(23)24)35-8-9-36-20(16-35)2-5-27(36)37/h3-4,6-7,13-15,17-20H,2,5,8-12,16,31H2,1H3,(H,34,38)/t17-,18+,19-,20?/m0/s1 |
| InChIKey | FESQQHZITNICEZ-COHPWVSRSA-N |
| XLogP | 4.06 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |