C16H19FN2O2 — CID 126739608
1-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]-N,5-dimethyl-2-oxopyridine-3-carboxamide (PubChem CID 126739608) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]-N,5-dimethyl-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]-N,5-dimethyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 126739608 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]-N,5-dimethyl-2-oxopyridine-3-carboxamide |
| SMILES | C=C/C(=C\C=C(/C)F)Cn1cc(C)cc(C(=O)NC)c1=O |
| InChI | InChI=1S/C16H19FN2O2/c1-5-13(7-6-12(3)17)10-19-9-11(2)8-14(16(19)21)15(20)18-4/h5-9H,1,10H2,2-4H3,(H,18,20)/b12-6+,13-7+ |
| InChIKey | FVSVOFLPLHWHSI-PWHKKFIBSA-N |
| XLogP | 2.50 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|