About 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine
2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine (PubChem CID 126739660) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine |
| PubChem CID | 126739660 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine |
| SMILES | C/C=c1/c(CCN)c[nH]/c1=C/C |
| InChI | InChI=1S/C10H16N2/c1-3-9-8(5-6-11)7-12-10(9)4-2/h3-4,7,12H,5-6,11H2,1-2H3/b9-3-,10-4+ |
| InChIKey | PKOAFXOGKJZJAT-INWPEIIHSA-N |
| XLogP | 0.12 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine?
The IUPAC name of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine (CID 126739660) is 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine.
What is the SMILES notation for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine?
The canonical SMILES for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine is C/C=c1/c(CCN)c[nH]/c1=C/C.
What is the InChIKey of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine?
The InChIKey is PKOAFXOGKJZJAT-INWPEIIHSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-9-8(5-6-11)7-12-10(9)4-2/h3-4,7,12H,5-6,11H2,1-2H3/b9-3-,10-4+.
What are the key properties of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine?
2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine has a molecular weight of 164.25 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]ethanamine is sourced from PubChem (CID 126739660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).