C22H28N4O4 — CID 126739685
1-benzyl-3-N-methyl-5-N-(3-morpholin-2-ylpropyl)-2-oxopyridine-3,5-dicarboxamide (PubChem CID 126739685) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-benzyl-3-N-methyl-5-N-(3-morpholin-2-ylpropyl)-2-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-3-N-methyl-5-N-(3-morpholin-2-ylpropyl)-2-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126739685 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-benzyl-3-N-methyl-5-N-(3-morpholin-2-ylpropyl)-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2CNCCO2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H28N4O4/c1-23-21(28)19-12-17(15-26(22(19)29)14-16-6-3-2-4-7-16)20(27)25-9-5-8-18-13-24-10-11-30-18/h2-4,6-7,12,15,18,24H,5,8-11,13-14H2,1H3,(H,23,28)(H,25,27) |
| InChIKey | CMAOQOYFIZBHPA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|