About dimethyl 2-hydroxybutanedioate
dimethyl 2-hydroxybutanedioate (PubChem CID 12674) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is dimethyl 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | dimethyl 2-hydroxybutanedioate |
| PubChem CID | 12674 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | dimethyl 2-hydroxybutanedioate |
| SMILES | COC(=O)CC(O)C(=O)OC |
| InChI | InChI=1S/C6H10O5/c1-10-5(8)3-4(7)6(9)11-2/h4,7H,3H2,1-2H3 |
| InChIKey | YSEKNCXYRGKTBJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-hydroxybutanedioate?
The IUPAC name of dimethyl 2-hydroxybutanedioate (CID 12674) is dimethyl 2-hydroxybutanedioate.
What is the SMILES notation for dimethyl 2-hydroxybutanedioate?
The canonical SMILES for dimethyl 2-hydroxybutanedioate is COC(=O)CC(O)C(=O)OC.
What is the InChIKey of dimethyl 2-hydroxybutanedioate?
The InChIKey is YSEKNCXYRGKTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5/c1-10-5(8)3-4(7)6(9)11-2/h4,7H,3H2,1-2H3.
What are the key properties of dimethyl 2-hydroxybutanedioate?
dimethyl 2-hydroxybutanedioate has a molecular weight of 162.14 g/mol, XLogP of -0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-hydroxybutanedioate is sourced from PubChem (CID 12674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).