C24H17BrN4O — CID 1267415
(9R,11R)-11-(4-bromophenyl)-9-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 1267415) has the molecular formula C24H17BrN4O and a molecular weight of 457.33 g/mol. Its IUPAC name is (9R,11R)-11-(4-bromophenyl)-9-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11R)-11-(4-bromophenyl)-9-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 1267415 |
| Molecular Formula | C24H17BrN4O |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (9R,11R)-11-(4-bromophenyl)-9-phenyl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Brc1ccc([C@@H]2C3=C(Nc4ncnn42)c2ccccc2O[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C24H17BrN4O/c25-17-12-10-15(11-13-17)22-20-21(28-24-26-14-27-29(22)24)18-8-4-5-9-19(18)30-23(20)16-6-2-1-3-7-16/h1-14,22-23H,(H,26,27,28)/t22-,23-/m1/s1 |
| InChIKey | MLIXMOSTTVOKLF-DHIUTWEWSA-N |
| XLogP | 5.60 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |