C29H34FN5O2 — CID 126741563
methyl 3-cyclobutyl-4-(1-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 126741563) has the molecular formula C29H34FN5O2 and a molecular weight of 503.62 g/mol. Its IUPAC name is methyl 3-cyclobutyl-4-(1-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine-6-carboxylate.
| Compound Name | methyl 3-cyclobutyl-4-(1-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 126741563 |
| Molecular Formula | C29H34FN5O2 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | methyl 3-cyclobutyl-4-(1-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc(N2CCC3C(CCN3C3CCC3)C2)c2c(C3CCC3)nn(-c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C29H34FN5O2/c1-37-29(36)23-16-25(33-14-13-24-19(17-33)12-15-34(24)21-6-3-7-21)26-27(18-4-2-5-18)32-35(28(26)31-23)22-10-8-20(30)9-11-22/h8-11,16,18-19,21,24H,2-7,12-15,17H2,1H3 |
| InChIKey | PGWSCNZYNOOCHU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |