C29H34FN5O3 — CID 126742172
3-cyclobutyl-1-(4-fluorophenyl)-4-[1-(oxan-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]pyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 126742172) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is 3-cyclobutyl-1-(4-fluorophenyl)-4-[1-(oxan-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]pyrazolo[5,4-b]pyridine-6-carboxylic acid.
| Compound Name | 3-cyclobutyl-1-(4-fluorophenyl)-4-[1-(oxan-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]pyrazolo[5,4-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 126742172 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 3-cyclobutyl-1-(4-fluorophenyl)-4-[1-(oxan-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(N2CCC3C(CCN3C3CCOCC3)C2)c2c(C3CCC3)nn(-c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C29H34FN5O3/c30-20-4-6-22(7-5-20)35-28-26(27(32-35)18-2-1-3-18)25(16-23(31-28)29(36)37)33-12-9-24-19(17-33)8-13-34(24)21-10-14-38-15-11-21/h4-7,16,18-19,21,24H,1-3,8-15,17H2,(H,36,37) |
| InChIKey | RYMVUSLVRIHOOA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |