C27H31N5O3 — CID 126742234
methyl 4-(1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-3-cyclobutyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 126742234) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is methyl 4-(1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-3-cyclobutyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate.
| Compound Name | methyl 4-(1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-3-cyclobutyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 126742234 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | methyl 4-(1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl)-3-cyclobutyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc(N2CCC3C(CCN3C(C)=O)C2)c2c(C3CCC3)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C27H31N5O3/c1-17(33)31-14-11-19-16-30(13-12-22(19)31)23-15-21(27(34)35-2)28-26-24(23)25(18-7-6-8-18)29-32(26)20-9-4-3-5-10-20/h3-5,9-10,15,18-19,22H,6-8,11-14,16H2,1-2H3 |
| InChIKey | DREYJVNUDWOGCC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |