About 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one
5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one (PubChem CID 12674226) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one.
Molecular Properties
| Compound Name | 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| PubChem CID | 12674226 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| SMILES | CC(C)(C)C1=CC2(CO2)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C15H22O2/c1-13(2,3)10-7-11(14(4,5)6)12(16)15(8-10)9-17-15/h7-8H,9H2,1-6H3 |
| InChIKey | BDBAWMGOWUSJRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The IUPAC name of 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one (CID 12674226) is 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one.
What is the SMILES notation for 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The canonical SMILES for 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one is CC(C)(C)C1=CC2(CO2)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The InChIKey is BDBAWMGOWUSJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-13(2,3)10-7-11(14(4,5)6)12(16)15(8-10)9-17-15/h7-8H,9H2,1-6H3.
What are the key properties of 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one?
5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one has a molecular weight of 234.34 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one is sourced from PubChem (CID 12674226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).