About 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol
2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol (PubChem CID 12674273) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol.
Molecular Properties
| Compound Name | 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol |
| PubChem CID | 12674273 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol |
| SMILES | CN1C2CC(S)C(C2)N1C |
| InChI | InChI=1S/C7H14N2S/c1-8-5-3-6(9(8)2)7(10)4-5/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | TVGBRSZCIOOLAB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol?
The IUPAC name of 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol (CID 12674273) is 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol.
What is the SMILES notation for 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol?
The canonical SMILES for 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol is CN1C2CC(S)C(C2)N1C.
What is the InChIKey of 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol?
The InChIKey is TVGBRSZCIOOLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c1-8-5-3-6(9(8)2)7(10)4-5/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol?
2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol has a molecular weight of 158.27 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2,3-diazabicyclo[2.2.1]heptane-5-thiol is sourced from PubChem (CID 12674273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).