C22H24N6O2 — CID 126743666
ethyl 4-[4-(cyanomethyl)piperazin-1-yl]-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 126743666) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 4-[4-(cyanomethyl)piperazin-1-yl]-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate.
| Compound Name | ethyl 4-[4-(cyanomethyl)piperazin-1-yl]-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 126743666 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethyl 4-[4-(cyanomethyl)piperazin-1-yl]-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cc(N2CCN(CC#N)CC2)c2c(C)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H24N6O2/c1-3-30-22(29)18-15-19(27-13-11-26(10-9-23)12-14-27)20-16(2)25-28(21(20)24-18)17-7-5-4-6-8-17/h4-8,15H,3,10-14H2,1-2H3 |
| InChIKey | OSBHCTPOKLRYDO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|